C19H23ClN4O3 — CID 55763673
N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-1-(cyclopropanecarbonyl)pyrrolidine-2-carboxamide (PubChem CID 55763673) has the molecular formula C19H23ClN4O3 and a molecular weight of 390.87 g/mol. Its IUPAC name is N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-1-(cyclopropanecarbonyl)pyrrolidine-2-carboxamide.
| Compound Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-1-(cyclopropanecarbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 55763673 |
| Molecular Formula | C19H23ClN4O3 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-1-(cyclopropanecarbonyl)pyrrolidine-2-carboxamide |
| SMILES | O=C1CN(c2ccc(NC(=O)C3CCCN3C(=O)C3CC3)cc2Cl)CCN1 |
| InChI | InChI=1S/C19H23ClN4O3/c20-14-10-13(5-6-15(14)23-9-7-21-17(25)11-23)22-18(26)16-2-1-8-24(16)19(27)12-3-4-12/h5-6,10,12,16H,1-4,7-9,11H2,(H,21,25)(H,22,26) |
| InChIKey | FGSWIFNPTJOSDZ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|