C21H23ClN4O4S — CID 46468044
N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-4-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 46468044) has the molecular formula C21H23ClN4O4S and a molecular weight of 462.96 g/mol. Its IUPAC name is N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-4-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-4-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 46468044 |
| Molecular Formula | C21H23ClN4O4S |
| Molecular Weight | 462.96 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-4-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | O=C1CN(c2ccc(NC(=O)c3ccc(S(=O)(=O)N4CCCC4)cc3)cc2Cl)CCN1 |
| InChI | InChI=1S/C21H23ClN4O4S/c22-18-13-16(5-8-19(18)25-12-9-23-20(27)14-25)24-21(28)15-3-6-17(7-4-15)31(29,30)26-10-1-2-11-26/h3-8,13H,1-2,9-12,14H2,(H,23,27)(H,24,28) |
| InChIKey | ZNNRJPJCMDTUIQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.96 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|