C21H22ClFN4O5S — CID 55661892
N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-4-fluoro-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 55661892) has the molecular formula C21H22ClFN4O5S and a molecular weight of 496.95 g/mol. Its IUPAC name is N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-4-fluoro-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-4-fluoro-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55661892 |
| Molecular Formula | C21H22ClFN4O5S |
| Molecular Weight | 496.95 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-4-fluoro-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C1CN(c2ccc(NC(=O)c3ccc(F)c(S(=O)(=O)N4CCOCC4)c3)cc2Cl)CCN1 |
| InChI | InChI=1S/C21H22ClFN4O5S/c22-16-12-15(2-4-18(16)26-6-5-24-20(28)13-26)25-21(29)14-1-3-17(23)19(11-14)33(30,31)27-7-9-32-10-8-27/h1-4,11-12H,5-10,13H2,(H,24,28)(H,25,29) |
| InChIKey | GJCUXKDGPSKTND-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.95 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|