C18H15F4N3O4S — CID 118229976
4-fluoro-3-[(3-oxo-1,4-diazepan-1-yl)sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 118229976) has the molecular formula C18H15F4N3O4S and a molecular weight of 445.39 g/mol. Its IUPAC name is 4-fluoro-3-[(3-oxo-1,4-diazepan-1-yl)sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-fluoro-3-[(3-oxo-1,4-diazepan-1-yl)sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 118229976 |
| Molecular Formula | C18H15F4N3O4S |
| Molecular Weight | 445.39 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | 4-fluoro-3-[(3-oxo-1,4-diazepan-1-yl)sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C1CN(S(=O)(=O)c2cc(C(=O)Nc3cc(F)c(F)c(F)c3)ccc2F)CCCN1 |
| InChI | InChI=1S/C18H15F4N3O4S/c19-12-3-2-10(18(27)24-11-7-13(20)17(22)14(21)8-11)6-15(12)30(28,29)25-5-1-4-23-16(26)9-25/h2-3,6-8H,1,4-5,9H2,(H,23,26)(H,24,27) |
| InChIKey | IYABXZLIADQWIC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|