C19H16F6N2O4S — CID 118230180
3-(3,3-difluoro-4-hydroxyazepan-1-yl)sulfonyl-4-fluoro-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 118230180) has the molecular formula C19H16F6N2O4S and a molecular weight of 482.40 g/mol. Its IUPAC name is 3-(3,3-difluoro-4-hydroxyazepan-1-yl)sulfonyl-4-fluoro-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 3-(3,3-difluoro-4-hydroxyazepan-1-yl)sulfonyl-4-fluoro-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 118230180 |
| Molecular Formula | C19H16F6N2O4S |
| Molecular Weight | 482.40 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | 3-(3,3-difluoro-4-hydroxyazepan-1-yl)sulfonyl-4-fluoro-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(F)c(S(=O)(=O)N2CCCC(O)C(F)(F)C2)c1 |
| InChI | InChI=1S/C19H16F6N2O4S/c20-12-4-3-10(18(29)26-11-7-13(21)17(23)14(22)8-11)6-15(12)32(30,31)27-5-1-2-16(28)19(24,25)9-27/h3-4,6-8,16,28H,1-2,5,9H2,(H,26,29) |
| InChIKey | MWSLWLQECVTDLM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|