C20H19F5N2O4S — CID 122547391
4-fluoro-3-(4-fluoro-5-hydroxyazocan-1-yl)sulfonyl-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 122547391) has the molecular formula C20H19F5N2O4S and a molecular weight of 478.44 g/mol. Its IUPAC name is 4-fluoro-3-(4-fluoro-5-hydroxyazocan-1-yl)sulfonyl-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-fluoro-3-(4-fluoro-5-hydroxyazocan-1-yl)sulfonyl-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 122547391 |
| Molecular Formula | C20H19F5N2O4S |
| Molecular Weight | 478.44 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 4-fluoro-3-(4-fluoro-5-hydroxyazocan-1-yl)sulfonyl-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(F)c(S(=O)(=O)N2CCCC(O)C(F)CC2)c1 |
| InChI | InChI=1S/C20H19F5N2O4S/c21-13-5-7-27(6-1-2-17(13)28)32(30,31)18-8-11(3-4-14(18)22)20(29)26-12-9-15(23)19(25)16(24)10-12/h3-4,8-10,13,17,28H,1-2,5-7H2,(H,26,29) |
| InChIKey | ICKPZNVCJIPIMV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|