C17H15F4N3O3S — CID 146301309
3-[(3S)-3-aminopyrrolidin-1-yl]sulfonyl-4-fluoro-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 146301309) has the molecular formula C17H15F4N3O3S and a molecular weight of 417.38 g/mol. Its IUPAC name is 3-[(3S)-3-aminopyrrolidin-1-yl]sulfonyl-4-fluoro-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 3-[(3S)-3-aminopyrrolidin-1-yl]sulfonyl-4-fluoro-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 146301309 |
| Molecular Formula | C17H15F4N3O3S |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 3-[(3S)-3-aminopyrrolidin-1-yl]sulfonyl-4-fluoro-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | N[C@H]1CCN(S(=O)(=O)c2cc(C(=O)Nc3cc(F)c(F)c(F)c3)ccc2F)C1 |
| InChI | InChI=1S/C17H15F4N3O3S/c18-12-2-1-9(5-15(12)28(26,27)24-4-3-10(22)8-24)17(25)23-11-6-13(19)16(21)14(20)7-11/h1-2,5-7,10H,3-4,8,22H2,(H,23,25)/t10-/m0/s1 |
| InChIKey | WTLPHWCFYAXFHF-JTQLQIEISA-N |
| XLogP | 2.22 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|