C17H14F4N2O4S2 — CID 118404422
4-fluoro-3-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 118404422) has the molecular formula C17H14F4N2O4S2 and a molecular weight of 450.44 g/mol. Its IUPAC name is 4-fluoro-3-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-fluoro-3-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 118404422 |
| Molecular Formula | C17H14F4N2O4S2 |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | 4-fluoro-3-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(F)c(S(=O)(=O)N2CCS(=O)CC2)c1 |
| InChI | InChI=1S/C17H14F4N2O4S2/c18-12-2-1-10(17(24)22-11-8-13(19)16(21)14(20)9-11)7-15(12)29(26,27)23-3-5-28(25)6-4-23/h1-2,7-9H,3-6H2,(H,22,24) |
| InChIKey | FWRQIGNSCUNCJT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|