C18H15F4N3O5S — CID 146301441
[1-[2-fluoro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonylpyrrolidin-3-yl]carbamic acid (PubChem CID 146301441) has the molecular formula C18H15F4N3O5S and a molecular weight of 461.39 g/mol. Its IUPAC name is [1-[2-fluoro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonylpyrrolidin-3-yl]carbamic acid.
| Compound Name | [1-[2-fluoro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonylpyrrolidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 146301441 |
| Molecular Formula | C18H15F4N3O5S |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | [1-[2-fluoro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonylpyrrolidin-3-yl]carbamic acid |
| SMILES | O=C(O)NC1CCN(S(=O)(=O)c2cc(C(=O)Nc3cc(F)c(F)c(F)c3)ccc2F)C1 |
| InChI | InChI=1S/C18H15F4N3O5S/c19-12-2-1-9(17(26)23-11-6-13(20)16(22)14(21)7-11)5-15(12)31(29,30)25-4-3-10(8-25)24-18(27)28/h1-2,5-7,10,24H,3-4,8H2,(H,23,26)(H,27,28) |
| InChIKey | SIVRKRSXNVDCCU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|