C19H17F4N3O5S — CID 146301482
[(1S,2S)-2-[[2-fluoro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonylamino]cyclopentyl]carbamic acid (PubChem CID 146301482) has the molecular formula C19H17F4N3O5S and a molecular weight of 475.42 g/mol. Its IUPAC name is [(1S,2S)-2-[[2-fluoro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonylamino]cyclopentyl]carbamic acid.
| Compound Name | [(1S,2S)-2-[[2-fluoro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonylamino]cyclopentyl]carbamic acid |
|---|---|
| PubChem CID | 146301482 |
| Molecular Formula | C19H17F4N3O5S |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | [(1S,2S)-2-[[2-fluoro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonylamino]cyclopentyl]carbamic acid |
| SMILES | O=C(O)N[C@H]1CCC[C@@H]1NS(=O)(=O)c1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1F |
| InChI | InChI=1S/C19H17F4N3O5S/c20-11-5-4-9(18(27)24-10-7-12(21)17(23)13(22)8-10)6-16(11)32(30,31)26-15-3-1-2-14(15)25-19(28)29/h4-8,14-15,25-26H,1-3H2,(H,24,27)(H,28,29)/t14-,15-/m0/s1 |
| InChIKey | ANFOWOMMOAXKAC-GJZGRUSLSA-N |
| XLogP | 2.96 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|