C20H19F4N3O5S — CID 146301412
[(2R)-1-[2-fluoro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonylpiperidin-2-yl]methylcarbamic acid (PubChem CID 146301412) has the molecular formula C20H19F4N3O5S and a molecular weight of 489.45 g/mol. Its IUPAC name is [(2R)-1-[2-fluoro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonylpiperidin-2-yl]methylcarbamic acid.
| Compound Name | [(2R)-1-[2-fluoro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonylpiperidin-2-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 146301412 |
| Molecular Formula | C20H19F4N3O5S |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | [(2R)-1-[2-fluoro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonylpiperidin-2-yl]methylcarbamic acid |
| SMILES | O=C(O)NC[C@H]1CCCCN1S(=O)(=O)c1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1F |
| InChI | InChI=1S/C20H19F4N3O5S/c21-14-5-4-11(19(28)26-12-8-15(22)18(24)16(23)9-12)7-17(14)33(31,32)27-6-2-1-3-13(27)10-25-20(29)30/h4-5,7-9,13,25H,1-3,6,10H2,(H,26,28)(H,29,30)/t13-/m1/s1 |
| InChIKey | ZOHFOUPPCIGYLV-CYBMUJFWSA-N |
| XLogP | 3.31 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|