C23H25F4N3O6S — CID 146304028
tert-butyl N-[[4-[2-fluoro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonylmorpholin-3-yl]methyl]carbamate (PubChem CID 146304028) has the molecular formula C23H25F4N3O6S and a molecular weight of 547.53 g/mol. Its IUPAC name is tert-butyl N-[[4-[2-fluoro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonylmorpholin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[2-fluoro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonylmorpholin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 146304028 |
| Molecular Formula | C23H25F4N3O6S |
| Molecular Weight | 547.53 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | tert-butyl N-[[4-[2-fluoro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonylmorpholin-3-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1COCCN1S(=O)(=O)c1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1F |
| InChI | InChI=1S/C23H25F4N3O6S/c1-23(2,3)36-22(32)28-11-15-12-35-7-6-30(15)37(33,34)19-8-13(4-5-16(19)24)21(31)29-14-9-17(25)20(27)18(26)10-14/h4-5,8-10,15H,6-7,11-12H2,1-3H3,(H,28,32)(H,29,31) |
| InChIKey | OKEISSRSCUFTMX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|