C24H24ClF3N2O5S — CID 130402119
methyl N-[[8-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-bicyclo[3.2.1]octanyl]methyl]carbamate (PubChem CID 130402119) has the molecular formula C24H24ClF3N2O5S and a molecular weight of 544.98 g/mol. Its IUPAC name is methyl N-[[8-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-bicyclo[3.2.1]octanyl]methyl]carbamate.
| Compound Name | methyl N-[[8-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-bicyclo[3.2.1]octanyl]methyl]carbamate |
|---|---|
| PubChem CID | 130402119 |
| Molecular Formula | C24H24ClF3N2O5S |
| Molecular Weight | 544.98 g/mol |
| Exact Mass | 544.10 |
| IUPAC Name | methyl N-[[8-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-bicyclo[3.2.1]octanyl]methyl]carbamate |
| SMILES | COC(=O)NCC1CC2CCC(C1)C2S(=O)(=O)c1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C24H24ClF3N2O5S/c1-35-24(32)29-11-12-6-13-2-3-14(7-12)22(13)36(33,34)20-8-15(4-5-17(20)25)23(31)30-16-9-18(26)21(28)19(27)10-16/h4-5,8-10,12-14,22H,2-3,6-7,11H2,1H3,(H,29,32)(H,30,31) |
| InChIKey | LVOPLLLSTUMZBH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.98 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|