C21H17ClF3NO4S — CID 130402368
4-chloro-3-[(3-oxo-8-bicyclo[3.2.1]octanyl)sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130402368) has the molecular formula C21H17ClF3NO4S and a molecular weight of 471.88 g/mol. Its IUPAC name is 4-chloro-3-[(3-oxo-8-bicyclo[3.2.1]octanyl)sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[(3-oxo-8-bicyclo[3.2.1]octanyl)sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130402368 |
| Molecular Formula | C21H17ClF3NO4S |
| Molecular Weight | 471.88 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | 4-chloro-3-[(3-oxo-8-bicyclo[3.2.1]octanyl)sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C1CC2CCC(C1)C2S(=O)(=O)c1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C21H17ClF3NO4S/c22-15-4-3-12(21(28)26-13-8-16(23)19(25)17(24)9-13)7-18(15)31(29,30)20-10-1-2-11(20)6-14(27)5-10/h3-4,7-11,20H,1-2,5-6H2,(H,26,28) |
| InChIKey | DBKYVCBGWVPXGZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.88 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|