C22H19ClF3NO6S — CID 130402223
8-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-hydroxybicyclo[3.2.1]octane-3-carboxylic acid (PubChem CID 130402223) has the molecular formula C22H19ClF3NO6S and a molecular weight of 517.91 g/mol. Its IUPAC name is 8-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-hydroxybicyclo[3.2.1]octane-3-carboxylic acid.
| Compound Name | 8-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-hydroxybicyclo[3.2.1]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 130402223 |
| Molecular Formula | C22H19ClF3NO6S |
| Molecular Weight | 517.91 g/mol |
| Exact Mass | 517.06 |
| IUPAC Name | 8-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-hydroxybicyclo[3.2.1]octane-3-carboxylic acid |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(Cl)c(S(=O)(=O)C2C3CCC2CC(O)(C(=O)O)C3)c1 |
| InChI | InChI=1S/C22H19ClF3NO6S/c23-14-4-3-10(20(28)27-13-6-15(24)18(26)16(25)7-13)5-17(14)34(32,33)19-11-1-2-12(19)9-22(31,8-11)21(29)30/h3-7,11-12,19,31H,1-2,8-9H2,(H,27,28)(H,29,30) |
| InChIKey | GTDWSBGPFRSMRX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.91 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|