C22H17ClF3NO4S — CID 167247007
4-chloro-3-[[(1S,2S,7R)-2-ethynyl-2-hydroxy-7-bicyclo[2.2.1]heptanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 167247007) has the molecular formula C22H17ClF3NO4S and a molecular weight of 483.90 g/mol. Its IUPAC name is 4-chloro-3-[[(1S,2S,7R)-2-ethynyl-2-hydroxy-7-bicyclo[2.2.1]heptanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[(1S,2S,7R)-2-ethynyl-2-hydroxy-7-bicyclo[2.2.1]heptanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 167247007 |
| Molecular Formula | C22H17ClF3NO4S |
| Molecular Weight | 483.90 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | 4-chloro-3-[[(1S,2S,7R)-2-ethynyl-2-hydroxy-7-bicyclo[2.2.1]heptanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | C#C[C@]1(O)CC2CC[C@@H]1[C@@H]2S(=O)(=O)c1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C22H17ClF3NO4S/c1-2-22(29)10-12-3-5-14(22)20(12)32(30,31)18-7-11(4-6-15(18)23)21(28)27-13-8-16(24)19(26)17(25)9-13/h1,4,6-9,12,14,20,29H,3,5,10H2,(H,27,28)/t12?,14-,20-,22+/m1/s1 |
| InChIKey | ZZSLDYBAUZBCTG-MOQRPQHMSA-N |
| XLogP | 3.95 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.90 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|