C25H23ClF3NO7S — CID 130425157
[(2R,7R)-2-acetyloxy-7-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-2-bicyclo[2.2.1]heptanyl]methyl acetate (PubChem CID 130425157) has the molecular formula C25H23ClF3NO7S and a molecular weight of 573.97 g/mol. Its IUPAC name is [(2R,7R)-2-acetyloxy-7-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-2-bicyclo[2.2.1]heptanyl]methyl acetate.
| Compound Name | [(2R,7R)-2-acetyloxy-7-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-2-bicyclo[2.2.1]heptanyl]methyl acetate |
|---|---|
| PubChem CID | 130425157 |
| Molecular Formula | C25H23ClF3NO7S |
| Molecular Weight | 573.97 g/mol |
| Exact Mass | 573.08 |
| IUPAC Name | [(2R,7R)-2-acetyloxy-7-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-2-bicyclo[2.2.1]heptanyl]methyl acetate |
| SMILES | CC(=O)OC[C@@]1(OC(C)=O)CC2CCC1[C@@H]2S(=O)(=O)c1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C25H23ClF3NO7S/c1-12(31)36-11-25(37-13(2)32)10-15-3-5-17(25)23(15)38(34,35)21-7-14(4-6-18(21)26)24(33)30-16-8-19(27)22(29)20(28)9-16/h4,6-9,15,17,23H,3,5,10-11H2,1-2H3,(H,30,33)/t15?,17?,23-,25+/m1/s1 |
| InChIKey | BDRWNLOCPZBGAN-IZDUFKDKSA-N |
| XLogP | 4.45 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.97 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|