C24H25ClF3NO6S — CID 130397596
4-chloro-3-[[(5S)-3-hydroxy-3-(2-hydroxyethoxymethyl)-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130397596) has the molecular formula C24H25ClF3NO6S and a molecular weight of 547.98 g/mol. Its IUPAC name is 4-chloro-3-[[(5S)-3-hydroxy-3-(2-hydroxyethoxymethyl)-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[(5S)-3-hydroxy-3-(2-hydroxyethoxymethyl)-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130397596 |
| Molecular Formula | C24H25ClF3NO6S |
| Molecular Weight | 547.98 g/mol |
| Exact Mass | 547.10 |
| IUPAC Name | 4-chloro-3-[[(5S)-3-hydroxy-3-(2-hydroxyethoxymethyl)-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(Cl)c(S(=O)(=O)C2C3CC[C@H]2CC(O)(COCCO)C3)c1 |
| InChI | InChI=1S/C24H25ClF3NO6S/c25-17-4-3-13(23(31)29-16-8-18(26)21(28)19(27)9-16)7-20(17)36(33,34)22-14-1-2-15(22)11-24(32,10-14)12-35-6-5-30/h3-4,7-9,14-15,22,30,32H,1-2,5-6,10-12H2,(H,29,31)/t14-,15?,22?,24?/m0/s1 |
| InChIKey | QEXWZCALRLPCPQ-UAVRNLFVSA-N |
| XLogP | 3.71 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.98 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|