C30H28ClF3N2O5S — CID 130402214
4-chloro-3-[[3-hydroxy-3-[[(E)-3-pyridin-4-ylprop-2-enoxy]methyl]-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130402214) has the molecular formula C30H28ClF3N2O5S and a molecular weight of 621.08 g/mol. Its IUPAC name is 4-chloro-3-[[3-hydroxy-3-[[(E)-3-pyridin-4-ylprop-2-enoxy]methyl]-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[3-hydroxy-3-[[(E)-3-pyridin-4-ylprop-2-enoxy]methyl]-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130402214 |
| Molecular Formula | C30H28ClF3N2O5S |
| Molecular Weight | 621.08 g/mol |
| Exact Mass | 620.14 |
| IUPAC Name | 4-chloro-3-[[3-hydroxy-3-[[(E)-3-pyridin-4-ylprop-2-enoxy]methyl]-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(Cl)c(S(=O)(=O)C2C3CCC2CC(O)(COC/C=C/c2ccncc2)C3)c1 |
| InChI | InChI=1S/C30H28ClF3N2O5S/c31-23-6-5-19(29(37)36-22-13-24(32)27(34)25(33)14-22)12-26(23)42(39,40)28-20-3-4-21(28)16-30(38,15-20)17-41-11-1-2-18-7-9-35-10-8-18/h1-2,5-10,12-14,20-21,28,38H,3-4,11,15-17H2,(H,36,37)/b2-1+ |
| InChIKey | MPHJZUMFLRRXQW-OWOJBTEDSA-N |
| XLogP | 5.83 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.08 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|