C25H26ClF3N2O6S — CID 130402221
[(5S)-8-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-hydroxy-3-bicyclo[3.2.1]octanyl]methyl N-ethylcarbamate (PubChem CID 130402221) has the molecular formula C25H26ClF3N2O6S and a molecular weight of 575.01 g/mol. Its IUPAC name is [(5S)-8-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-hydroxy-3-bicyclo[3.2.1]octanyl]methyl N-ethylcarbamate.
| Compound Name | [(5S)-8-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-hydroxy-3-bicyclo[3.2.1]octanyl]methyl N-ethylcarbamate |
|---|---|
| PubChem CID | 130402221 |
| Molecular Formula | C25H26ClF3N2O6S |
| Molecular Weight | 575.01 g/mol |
| Exact Mass | 574.12 |
| IUPAC Name | [(5S)-8-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-hydroxy-3-bicyclo[3.2.1]octanyl]methyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCC1(O)CC2CC[C@@H](C1)C2S(=O)(=O)c1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C25H26ClF3N2O6S/c1-2-30-24(33)37-12-25(34)10-14-3-4-15(11-25)22(14)38(35,36)20-7-13(5-6-17(20)26)23(32)31-16-8-18(27)21(29)19(28)9-16/h5-9,14-15,22,34H,2-4,10-12H2,1H3,(H,30,33)(H,31,32)/t14-,15?,22?,25?/m0/s1 |
| InChIKey | IUFKKTNUFPWKOI-WKUFUIMJSA-N |
| XLogP | 4.45 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.01 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|