C25H29F3N2O7S2 — CID 130402058
[8-[2-(dimethylamino)-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-hydroxy-3-bicyclo[3.2.1]octanyl]methyl methanesulfonate (PubChem CID 130402058) has the molecular formula C25H29F3N2O7S2 and a molecular weight of 590.64 g/mol. Its IUPAC name is [8-[2-(dimethylamino)-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-hydroxy-3-bicyclo[3.2.1]octanyl]methyl methanesulfonate.
| Compound Name | [8-[2-(dimethylamino)-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-hydroxy-3-bicyclo[3.2.1]octanyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 130402058 |
| Molecular Formula | C25H29F3N2O7S2 |
| Molecular Weight | 590.64 g/mol |
| Exact Mass | 590.14 |
| IUPAC Name | [8-[2-(dimethylamino)-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-hydroxy-3-bicyclo[3.2.1]octanyl]methyl methanesulfonate |
| SMILES | CN(C)c1ccc(C(=O)Nc2cc(F)c(F)c(F)c2)cc1S(=O)(=O)C1C2CCC1CC(O)(COS(C)(=O)=O)C2 |
| InChI | InChI=1S/C25H29F3N2O7S2/c1-30(2)20-7-6-14(24(31)29-17-9-18(26)22(28)19(27)10-17)8-21(20)39(35,36)23-15-4-5-16(23)12-25(32,11-15)13-37-38(3,33)34/h6-10,15-16,23,32H,4-5,11-13H2,1-3H3,(H,29,31) |
| InChIKey | QZUBTLDMMDPLHL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.64 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|