C22H21ClF3NO7S2 — CID 167246579
[(1S,2R,7R)-7-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-2-hydroxy-2-bicyclo[2.2.1]heptanyl]methyl methanesulfonate (PubChem CID 167246579) has the molecular formula C22H21ClF3NO7S2 and a molecular weight of 567.99 g/mol. Its IUPAC name is [(1S,2R,7R)-7-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-2-hydroxy-2-bicyclo[2.2.1]heptanyl]methyl methanesulfonate.
| Compound Name | [(1S,2R,7R)-7-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-2-hydroxy-2-bicyclo[2.2.1]heptanyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 167246579 |
| Molecular Formula | C22H21ClF3NO7S2 |
| Molecular Weight | 567.99 g/mol |
| Exact Mass | 567.04 |
| IUPAC Name | [(1S,2R,7R)-7-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-2-hydroxy-2-bicyclo[2.2.1]heptanyl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@@]1(O)CC2CC[C@@H]1[C@@H]2S(=O)(=O)c1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C22H21ClF3NO7S2/c1-35(30,31)34-10-22(29)9-12-2-4-14(22)20(12)36(32,33)18-6-11(3-5-15(18)23)21(28)27-13-7-16(24)19(26)17(25)8-13/h3,5-8,12,14,20,29H,2,4,9-10H2,1H3,(H,27,28)/t12?,14-,20-,22+/m1/s1 |
| InChIKey | MCIZRKJMBHMILT-MOQRPQHMSA-N |
| XLogP | 3.29 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.99 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|