C28H23ClF4N2O5S — CID 130425284
4-chloro-3-[[(2R,7R)-2-[(E)-(2-fluorophenyl)methoxyiminomethyl]-2-hydroxy-7-bicyclo[2.2.1]heptanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130425284) has the molecular formula C28H23ClF4N2O5S and a molecular weight of 611.01 g/mol. Its IUPAC name is 4-chloro-3-[[(2R,7R)-2-[(E)-(2-fluorophenyl)methoxyiminomethyl]-2-hydroxy-7-bicyclo[2.2.1]heptanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[(2R,7R)-2-[(E)-(2-fluorophenyl)methoxyiminomethyl]-2-hydroxy-7-bicyclo[2.2.1]heptanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130425284 |
| Molecular Formula | C28H23ClF4N2O5S |
| Molecular Weight | 611.01 g/mol |
| Exact Mass | 610.10 |
| IUPAC Name | 4-chloro-3-[[(2R,7R)-2-[(E)-(2-fluorophenyl)methoxyiminomethyl]-2-hydroxy-7-bicyclo[2.2.1]heptanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(Cl)c(S(=O)(=O)[C@@H]2C3CCC2[C@@](O)(/C=N/OCc2ccccc2F)C3)c1 |
| InChI | InChI=1S/C28H23ClF4N2O5S/c29-20-8-6-15(27(36)35-18-10-22(31)25(33)23(32)11-18)9-24(20)41(38,39)26-16-5-7-19(26)28(37,12-16)14-34-40-13-17-3-1-2-4-21(17)30/h1-4,6,8-11,14,16,19,26,37H,5,7,12-13H2,(H,35,36)/b34-14+/t16?,19?,26-,28+/m1/s1 |
| InChIKey | XSFXHYGJYHCFBZ-NZWBBSAYSA-N |
| XLogP | 5.65 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.01 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|