C29H25ClF3N3O7S — CID 130402074
4-chloro-3-[[3-hydroxy-3-[(E)-(4-nitrophenyl)methoxyiminomethyl]-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130402074) has the molecular formula C29H25ClF3N3O7S and a molecular weight of 652.05 g/mol. Its IUPAC name is 4-chloro-3-[[3-hydroxy-3-[(E)-(4-nitrophenyl)methoxyiminomethyl]-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[3-hydroxy-3-[(E)-(4-nitrophenyl)methoxyiminomethyl]-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130402074 |
| Molecular Formula | C29H25ClF3N3O7S |
| Molecular Weight | 652.05 g/mol |
| Exact Mass | 651.11 |
| IUPAC Name | 4-chloro-3-[[3-hydroxy-3-[(E)-(4-nitrophenyl)methoxyiminomethyl]-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(Cl)c(S(=O)(=O)C2C3CCC2CC(O)(/C=N/OCc2ccc([N+](=O)[O-])cc2)C3)c1 |
| InChI | InChI=1S/C29H25ClF3N3O7S/c30-22-8-5-17(28(37)35-20-10-23(31)26(33)24(32)11-20)9-25(22)44(41,42)27-18-3-4-19(27)13-29(38,12-18)15-34-43-14-16-1-6-21(7-2-16)36(39)40/h1-2,5-11,15,18-19,27,38H,3-4,12-14H2,(H,35,37)/b34-15+ |
| InChIKey | ZVQJRLHEYGQNHT-PUHLOBNQSA-N |
| XLogP | 5.81 |
| TPSA | 148.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.05 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|