C31H30ClF3N2O6S — CID 166671890
4-chloro-3-[[(1S,3R,6S)-3-hydroxy-3-[(E)-(2-methoxyphenyl)methoxyiminomethyl]-6-methyl-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 166671890) has the molecular formula C31H30ClF3N2O6S and a molecular weight of 651.10 g/mol. Its IUPAC name is 4-chloro-3-[[(1S,3R,6S)-3-hydroxy-3-[(E)-(2-methoxyphenyl)methoxyiminomethyl]-6-methyl-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[(1S,3R,6S)-3-hydroxy-3-[(E)-(2-methoxyphenyl)methoxyiminomethyl]-6-methyl-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 166671890 |
| Molecular Formula | C31H30ClF3N2O6S |
| Molecular Weight | 651.10 g/mol |
| Exact Mass | 650.15 |
| IUPAC Name | 4-chloro-3-[[(1S,3R,6S)-3-hydroxy-3-[(E)-(2-methoxyphenyl)methoxyiminomethyl]-6-methyl-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | COc1ccccc1CO/N=C/[C@]1(O)CC2C(S(=O)(=O)c3cc(C(=O)Nc4cc(F)c(F)c(F)c4)ccc3Cl)[C@@H](C[C@@H]2C)C1 |
| InChI | InChI=1S/C31H30ClF3N2O6S/c1-17-9-20-13-31(39,16-36-43-15-19-5-3-4-6-26(19)42-2)14-22(17)29(20)44(40,41)27-10-18(7-8-23(27)32)30(38)37-21-11-24(33)28(35)25(34)12-21/h3-8,10-12,16-17,20,22,29,39H,9,13-15H2,1-2H3,(H,37,38)/b36-16+/t17-,20-,22?,29?,31+/m0/s1 |
| InChIKey | CDRSDGMICSLJRF-FNUCYNQGSA-N |
| XLogP | 6.16 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.10 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|