C23H23ClF3NO4S — CID 154959468
4-chloro-3-[[(6S,8R)-8-(hydroxymethyl)-6-methyl-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 154959468) has the molecular formula C23H23ClF3NO4S and a molecular weight of 501.95 g/mol. Its IUPAC name is 4-chloro-3-[[(6S,8R)-8-(hydroxymethyl)-6-methyl-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[(6S,8R)-8-(hydroxymethyl)-6-methyl-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 154959468 |
| Molecular Formula | C23H23ClF3NO4S |
| Molecular Weight | 501.95 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | 4-chloro-3-[[(6S,8R)-8-(hydroxymethyl)-6-methyl-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | C[C@H]1CC2CC(S(=O)(=O)c3cc(C(=O)Nc4cc(F)c(F)c(F)c4)ccc3Cl)CC1[C@@H]2CO |
| InChI | InChI=1S/C23H23ClF3NO4S/c1-11-4-13-5-15(9-16(11)17(13)10-29)33(31,32)21-6-12(2-3-18(21)24)23(30)28-14-7-19(25)22(27)20(26)8-14/h2-3,6-8,11,13,15-17,29H,4-5,9-10H2,1H3,(H,28,30)/t11-,13?,15?,16?,17+/m0/s1 |
| InChIKey | YVVZYKSQLKIYMA-SZPDCQORSA-N |
| XLogP | 4.83 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.95 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|