C23H23ClF3NO5S — CID 138479998
4-chloro-3-[[9-hydroxy-9-(hydroxymethyl)-3-bicyclo[3.3.1]nonanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 138479998) has the molecular formula C23H23ClF3NO5S and a molecular weight of 517.95 g/mol. Its IUPAC name is 4-chloro-3-[[9-hydroxy-9-(hydroxymethyl)-3-bicyclo[3.3.1]nonanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[9-hydroxy-9-(hydroxymethyl)-3-bicyclo[3.3.1]nonanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 138479998 |
| Molecular Formula | C23H23ClF3NO5S |
| Molecular Weight | 517.95 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | 4-chloro-3-[[9-hydroxy-9-(hydroxymethyl)-3-bicyclo[3.3.1]nonanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(Cl)c(S(=O)(=O)C2CC3CCCC(C2)C3(O)CO)c1 |
| InChI | InChI=1S/C23H23ClF3NO5S/c24-17-5-4-12(22(30)28-15-9-18(25)21(27)19(26)10-15)6-20(17)34(32,33)16-7-13-2-1-3-14(8-16)23(13,31)11-29/h4-6,9-10,13-14,16,29,31H,1-3,7-8,11H2,(H,28,30) |
| InChIKey | OFGUTUGLECVWFQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.95 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|