C24H25ClF3NO6S2 — CID 148607380
4-chloro-3-[[(5S)-8-hydroxy-8-(2-methylsulfonylethyl)-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 148607380) has the molecular formula C24H25ClF3NO6S2 and a molecular weight of 580.05 g/mol. Its IUPAC name is 4-chloro-3-[[(5S)-8-hydroxy-8-(2-methylsulfonylethyl)-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[(5S)-8-hydroxy-8-(2-methylsulfonylethyl)-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 148607380 |
| Molecular Formula | C24H25ClF3NO6S2 |
| Molecular Weight | 580.05 g/mol |
| Exact Mass | 579.08 |
| IUPAC Name | 4-chloro-3-[[(5S)-8-hydroxy-8-(2-methylsulfonylethyl)-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | CS(=O)(=O)CCC1(O)C2CC[C@H]1CC(S(=O)(=O)c1cc(C(=O)Nc3cc(F)c(F)c(F)c3)ccc1Cl)C2 |
| InChI | InChI=1S/C24H25ClF3NO6S2/c1-36(32,33)7-6-24(31)14-3-4-15(24)10-17(9-14)37(34,35)21-8-13(2-5-18(21)25)23(30)29-16-11-19(26)22(28)20(27)12-16/h2,5,8,11-12,14-15,17,31H,3-4,6-7,9-10H2,1H3,(H,29,30)/t14-,15?,17?,24?/m0/s1 |
| InChIKey | NDRUMFTZUFKEIC-FGKJPSRXSA-N |
| XLogP | 4.14 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.05 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|