C25H27ClF3NO6S — CID 170075836
4-chloro-3-[[(5S)-8-hydroxy-8-(2-hydroxypropoxymethyl)-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 170075836) has the molecular formula C25H27ClF3NO6S and a molecular weight of 562.01 g/mol. Its IUPAC name is 4-chloro-3-[[(5S)-8-hydroxy-8-(2-hydroxypropoxymethyl)-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[(5S)-8-hydroxy-8-(2-hydroxypropoxymethyl)-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 170075836 |
| Molecular Formula | C25H27ClF3NO6S |
| Molecular Weight | 562.01 g/mol |
| Exact Mass | 561.12 |
| IUPAC Name | 4-chloro-3-[[(5S)-8-hydroxy-8-(2-hydroxypropoxymethyl)-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | CC(O)COCC1(O)C2CC[C@H]1CC(S(=O)(=O)c1cc(C(=O)Nc3cc(F)c(F)c(F)c3)ccc1Cl)C2 |
| InChI | InChI=1S/C25H27ClF3NO6S/c1-13(31)11-36-12-25(33)15-3-4-16(25)8-18(7-15)37(34,35)22-6-14(2-5-19(22)26)24(32)30-17-9-20(27)23(29)21(28)10-17/h2,5-6,9-10,13,15-16,18,31,33H,3-4,7-8,11-12H2,1H3,(H,30,32)/t13?,15-,16?,18?,25?/m0/s1 |
| InChIKey | AGAMIELUKKHRMS-YSVSCSPQSA-N |
| XLogP | 4.10 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.01 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|