C26H29ClF3NO7S — CID 142538231
4-chloro-3-[[8-[[(2S,3S)-2,3-dihydroxybutoxy]methyl]-8-hydroxy-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 142538231) has the molecular formula C26H29ClF3NO7S and a molecular weight of 592.03 g/mol. Its IUPAC name is 4-chloro-3-[[8-[[(2S,3S)-2,3-dihydroxybutoxy]methyl]-8-hydroxy-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[8-[[(2S,3S)-2,3-dihydroxybutoxy]methyl]-8-hydroxy-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 142538231 |
| Molecular Formula | C26H29ClF3NO7S |
| Molecular Weight | 592.03 g/mol |
| Exact Mass | 591.13 |
| IUPAC Name | 4-chloro-3-[[8-[[(2S,3S)-2,3-dihydroxybutoxy]methyl]-8-hydroxy-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | C[C@H](O)[C@@H](O)COCC1(O)C2CCC1CC(S(=O)(=O)c1cc(C(=O)Nc3cc(F)c(F)c(F)c3)ccc1Cl)C2 |
| InChI | InChI=1S/C26H29ClF3NO7S/c1-13(32)22(33)11-38-12-26(35)15-3-4-16(26)8-18(7-15)39(36,37)23-6-14(2-5-19(23)27)25(34)31-17-9-20(28)24(30)21(29)10-17/h2,5-6,9-10,13,15-16,18,22,32-33,35H,3-4,7-8,11-12H2,1H3,(H,31,34)/t13-,15?,16?,18?,22-,26?/m0/s1 |
| InChIKey | FONVPYIVQRSTEH-IMPQOCOOSA-N |
| XLogP | 3.46 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.03 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|