C23H23ClF3NO3S — CID 137409721
4-chloro-3-[[(5S)-8,8-dimethyl-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 137409721) has the molecular formula C23H23ClF3NO3S and a molecular weight of 485.96 g/mol. Its IUPAC name is 4-chloro-3-[[(5S)-8,8-dimethyl-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[(5S)-8,8-dimethyl-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 137409721 |
| Molecular Formula | C23H23ClF3NO3S |
| Molecular Weight | 485.96 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 4-chloro-3-[[(5S)-8,8-dimethyl-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | CC1(C)C2CC[C@H]1CC(S(=O)(=O)c1cc(C(=O)Nc3cc(F)c(F)c(F)c3)ccc1Cl)C2 |
| InChI | InChI=1S/C23H23ClF3NO3S/c1-23(2)13-4-5-14(23)9-16(8-13)32(30,31)20-7-12(3-6-17(20)24)22(29)28-15-10-18(25)21(27)19(26)11-15/h3,6-7,10-11,13-14,16H,4-5,8-9H2,1-2H3,(H,28,29)/t13-,14?,16?/m0/s1 |
| InChIKey | VFLXQUSXKXPROI-HLIUYOAVSA-N |
| XLogP | 6.00 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.96 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|