C27H24ClF3N2O4S — CID 130397618
4-chloro-3-[[(5S)-8-hydroxy-8-(6-methyl-3-pyridinyl)-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130397618) has the molecular formula C27H24ClF3N2O4S and a molecular weight of 565.01 g/mol. Its IUPAC name is 4-chloro-3-[[(5S)-8-hydroxy-8-(6-methyl-3-pyridinyl)-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[(5S)-8-hydroxy-8-(6-methyl-3-pyridinyl)-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130397618 |
| Molecular Formula | C27H24ClF3N2O4S |
| Molecular Weight | 565.01 g/mol |
| Exact Mass | 564.11 |
| IUPAC Name | 4-chloro-3-[[(5S)-8-hydroxy-8-(6-methyl-3-pyridinyl)-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | Cc1ccc(C2(O)C3CC[C@H]2CC(S(=O)(=O)c2cc(C(=O)Nc4cc(F)c(F)c(F)c4)ccc2Cl)C3)cn1 |
| InChI | InChI=1S/C27H24ClF3N2O4S/c1-14-2-4-18(13-32-14)27(35)16-5-6-17(27)10-20(9-16)38(36,37)24-8-15(3-7-21(24)28)26(34)33-19-11-22(29)25(31)23(30)12-19/h2-4,7-8,11-13,16-17,20,35H,5-6,9-10H2,1H3,(H,33,34)/t16-,17?,20?,27?/m0/s1 |
| InChIKey | QZMSXPHBVLTXKQ-WOMCPLRWSA-N |
| XLogP | 5.56 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.01 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|