C25H23ClF3N3O4S — CID 130397448
4-chloro-3-[[(5S)-8-hydroxy-8-(pyrazol-1-ylmethyl)-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130397448) has the molecular formula C25H23ClF3N3O4S and a molecular weight of 553.99 g/mol. Its IUPAC name is 4-chloro-3-[[(5S)-8-hydroxy-8-(pyrazol-1-ylmethyl)-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[(5S)-8-hydroxy-8-(pyrazol-1-ylmethyl)-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130397448 |
| Molecular Formula | C25H23ClF3N3O4S |
| Molecular Weight | 553.99 g/mol |
| Exact Mass | 553.10 |
| IUPAC Name | 4-chloro-3-[[(5S)-8-hydroxy-8-(pyrazol-1-ylmethyl)-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(Cl)c(S(=O)(=O)C2CC3CC[C@@H](C2)C3(O)Cn2cccn2)c1 |
| InChI | InChI=1S/C25H23ClF3N3O4S/c26-19-5-2-14(24(33)31-17-11-20(27)23(29)21(28)12-17)8-22(19)37(35,36)18-9-15-3-4-16(10-18)25(15,34)13-32-7-1-6-30-32/h1-2,5-8,11-12,15-16,18,34H,3-4,9-10,13H2,(H,31,33)/t15-,16?,18?,25?/m0/s1 |
| InChIKey | BGRIXUAOWKQNEK-ZGQZOSPKSA-N |
| XLogP | 4.60 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.99 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|