C27H25ClF3N3O6S2 — CID 130424962
4-chloro-3-[[8-hydroxy-8-[(pyridin-3-ylsulfonylamino)methyl]-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130424962) has the molecular formula C27H25ClF3N3O6S2 and a molecular weight of 644.09 g/mol. Its IUPAC name is 4-chloro-3-[[8-hydroxy-8-[(pyridin-3-ylsulfonylamino)methyl]-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[8-hydroxy-8-[(pyridin-3-ylsulfonylamino)methyl]-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130424962 |
| Molecular Formula | C27H25ClF3N3O6S2 |
| Molecular Weight | 644.09 g/mol |
| Exact Mass | 643.08 |
| IUPAC Name | 4-chloro-3-[[8-hydroxy-8-[(pyridin-3-ylsulfonylamino)methyl]-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(Cl)c(S(=O)(=O)C2CC3CCC(C2)C3(O)CNS(=O)(=O)c2cccnc2)c1 |
| InChI | InChI=1S/C27H25ClF3N3O6S2/c28-21-6-3-15(26(35)34-18-11-22(29)25(31)23(30)12-18)8-24(21)41(37,38)20-9-16-4-5-17(10-20)27(16,36)14-33-42(39,40)19-2-1-7-32-13-19/h1-3,6-8,11-13,16-17,20,33,36H,4-5,9-10,14H2,(H,34,35) |
| InChIKey | VWDXOQAISXCGFB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 142.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.09 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|