C27H27ClF3NO5S — CID 159343994
4-chloro-3-[[8-hydroxy-8-[(E)-3-oxohex-4-enyl]-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 159343994) has the molecular formula C27H27ClF3NO5S and a molecular weight of 570.03 g/mol. Its IUPAC name is 4-chloro-3-[[8-hydroxy-8-[(E)-3-oxohex-4-enyl]-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[8-hydroxy-8-[(E)-3-oxohex-4-enyl]-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 159343994 |
| Molecular Formula | C27H27ClF3NO5S |
| Molecular Weight | 570.03 g/mol |
| Exact Mass | 569.13 |
| IUPAC Name | 4-chloro-3-[[8-hydroxy-8-[(E)-3-oxohex-4-enyl]-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | C/C=C/C(=O)CCC1(O)C2CCC1CC(S(=O)(=O)c1cc(C(=O)Nc3cc(F)c(F)c(F)c3)ccc1Cl)C2 |
| InChI | InChI=1S/C27H27ClF3NO5S/c1-2-3-19(33)8-9-27(35)16-5-6-17(27)12-20(11-16)38(36,37)24-10-15(4-7-21(24)28)26(34)32-18-13-22(29)25(31)23(30)14-18/h2-4,7,10,13-14,16-17,20,35H,5-6,8-9,11-12H2,1H3,(H,32,34)/b3-2+ |
| InChIKey | LGMJLIORYWEZKK-NSCUHMNNSA-N |
| XLogP | 5.63 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.03 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|