C23H23ClF3NO5S — CID 154959406
4-chloro-3-[[(5R,6S,8R)-8-hydroxy-8-(hydroxymethyl)-6-methyl-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 154959406) has the molecular formula C23H23ClF3NO5S and a molecular weight of 517.95 g/mol. Its IUPAC name is 4-chloro-3-[[(5R,6S,8R)-8-hydroxy-8-(hydroxymethyl)-6-methyl-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[(5R,6S,8R)-8-hydroxy-8-(hydroxymethyl)-6-methyl-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 154959406 |
| Molecular Formula | C23H23ClF3NO5S |
| Molecular Weight | 517.95 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | 4-chloro-3-[[(5R,6S,8R)-8-hydroxy-8-(hydroxymethyl)-6-methyl-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | C[C@H]1CC2CC(S(=O)(=O)c3cc(C(=O)Nc4cc(F)c(F)c(F)c4)ccc3Cl)C[C@H]1[C@@]2(O)CO |
| InChI | InChI=1S/C23H23ClF3NO5S/c1-11-4-13-6-15(9-16(11)23(13,31)10-29)34(32,33)20-5-12(2-3-17(20)24)22(30)28-14-7-18(25)21(27)19(26)8-14/h2-3,5,7-8,11,13,15-16,29,31H,4,6,9-10H2,1H3,(H,28,30)/t11-,13?,15?,16+,23+/m0/s1 |
| InChIKey | FHSCAQSUXIZFBY-HWJXUFBMSA-N |
| XLogP | 3.94 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.95 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|