C26H29ClF3NO6S — CID 166736044
4-chloro-3-[[(6S,8R)-8-hydroxy-8-(2-methoxyethoxymethyl)-6-methyl-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 166736044) has the molecular formula C26H29ClF3NO6S and a molecular weight of 576.03 g/mol. Its IUPAC name is 4-chloro-3-[[(6S,8R)-8-hydroxy-8-(2-methoxyethoxymethyl)-6-methyl-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[(6S,8R)-8-hydroxy-8-(2-methoxyethoxymethyl)-6-methyl-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 166736044 |
| Molecular Formula | C26H29ClF3NO6S |
| Molecular Weight | 576.03 g/mol |
| Exact Mass | 575.14 |
| IUPAC Name | 4-chloro-3-[[(6S,8R)-8-hydroxy-8-(2-methoxyethoxymethyl)-6-methyl-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | COCCOC[C@@]1(O)C2CC(S(=O)(=O)c3cc(C(=O)Nc4cc(F)c(F)c(F)c4)ccc3Cl)CC1[C@@H](C)C2 |
| InChI | InChI=1S/C26H29ClF3NO6S/c1-14-7-16-9-18(12-19(14)26(16,33)13-37-6-5-36-2)38(34,35)23-8-15(3-4-20(23)27)25(32)31-17-10-21(28)24(30)22(29)11-17/h3-4,8,10-11,14,16,18-19,33H,5-7,9,12-13H2,1-2H3,(H,31,32)/t14-,16?,18?,19?,26+/m0/s1 |
| InChIKey | YQAWOXFZUFIXRF-KFJROVPYSA-N |
| XLogP | 4.61 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.03 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|