C26H28ClF3N2O7S — CID 154959512
methyl N-[2-[(6S,8R)-3-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-8-hydroxy-6-methyl-8-bicyclo[3.2.1]octanyl]-2-hydroxyethyl]carbamate (PubChem CID 154959512) has the molecular formula C26H28ClF3N2O7S and a molecular weight of 605.03 g/mol. Its IUPAC name is methyl N-[2-[(6S,8R)-3-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-8-hydroxy-6-methyl-8-bicyclo[3.2.1]octanyl]-2-hydroxyethyl]carbamate.
| Compound Name | methyl N-[2-[(6S,8R)-3-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-8-hydroxy-6-methyl-8-bicyclo[3.2.1]octanyl]-2-hydroxyethyl]carbamate |
|---|---|
| PubChem CID | 154959512 |
| Molecular Formula | C26H28ClF3N2O7S |
| Molecular Weight | 605.03 g/mol |
| Exact Mass | 604.13 |
| IUPAC Name | methyl N-[2-[(6S,8R)-3-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-8-hydroxy-6-methyl-8-bicyclo[3.2.1]octanyl]-2-hydroxyethyl]carbamate |
| SMILES | COC(=O)NCC(O)[C@@]1(O)C2CC(S(=O)(=O)c3cc(C(=O)Nc4cc(F)c(F)c(F)c4)ccc3Cl)CC1[C@@H](C)C2 |
| InChI | InChI=1S/C26H28ClF3N2O7S/c1-12-5-14-7-16(10-17(12)26(14,36)22(33)11-31-25(35)39-2)40(37,38)21-6-13(3-4-18(21)27)24(34)32-15-8-19(28)23(30)20(29)9-15/h3-4,6,8-9,12,14,16-17,22,33,36H,5,7,10-11H2,1-2H3,(H,31,35)(H,32,34)/t12-,14?,16?,17?,22?,26+/m0/s1 |
| InChIKey | WOXJVJXZDHYTNE-XWACUKOWSA-N |
| XLogP | 3.67 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.03 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|