C25H27ClF3NO6S — CID 166736221
4-chloro-3-[[(6S,8R)-8-[(1R)-1,3-dihydroxypropyl]-8-hydroxy-6-methyl-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 166736221) has the molecular formula C25H27ClF3NO6S and a molecular weight of 562.01 g/mol. Its IUPAC name is 4-chloro-3-[[(6S,8R)-8-[(1R)-1,3-dihydroxypropyl]-8-hydroxy-6-methyl-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[(6S,8R)-8-[(1R)-1,3-dihydroxypropyl]-8-hydroxy-6-methyl-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 166736221 |
| Molecular Formula | C25H27ClF3NO6S |
| Molecular Weight | 562.01 g/mol |
| Exact Mass | 561.12 |
| IUPAC Name | 4-chloro-3-[[(6S,8R)-8-[(1R)-1,3-dihydroxypropyl]-8-hydroxy-6-methyl-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | C[C@H]1CC2CC(S(=O)(=O)c3cc(C(=O)Nc4cc(F)c(F)c(F)c4)ccc3Cl)CC1[C@@]2(O)[C@H](O)CCO |
| InChI | InChI=1S/C25H27ClF3NO6S/c1-12-6-14-8-16(11-17(12)25(14,34)22(32)4-5-31)37(35,36)21-7-13(2-3-18(21)26)24(33)30-15-9-19(27)23(29)20(28)10-15/h2-3,7,9-10,12,14,16-17,22,31-32,34H,4-6,8,11H2,1H3,(H,30,33)/t12-,14?,16?,17?,22+,25+/m0/s1 |
| InChIKey | LUXMAKPTPLFGQV-YHQLTDBASA-N |
| XLogP | 3.69 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.01 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|