C23H22ClF2NO6S — CID 174096161
(3R,5R,6S,8R)-3-[2-chloro-5-[(3,4-difluorophenyl)carbamoyl]phenyl]sulfonyl-8-hydroxy-6-methylbicyclo[3.2.1]octane-8-carboxylic acid (PubChem CID 174096161) has the molecular formula C23H22ClF2NO6S and a molecular weight of 513.95 g/mol. Its IUPAC name is (3R,5R,6S,8R)-3-[2-chloro-5-[(3,4-difluorophenyl)carbamoyl]phenyl]sulfonyl-8-hydroxy-6-methylbicyclo[3.2.1]octane-8-carboxylic acid.
| Compound Name | (3R,5R,6S,8R)-3-[2-chloro-5-[(3,4-difluorophenyl)carbamoyl]phenyl]sulfonyl-8-hydroxy-6-methylbicyclo[3.2.1]octane-8-carboxylic acid |
|---|---|
| PubChem CID | 174096161 |
| Molecular Formula | C23H22ClF2NO6S |
| Molecular Weight | 513.95 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | (3R,5R,6S,8R)-3-[2-chloro-5-[(3,4-difluorophenyl)carbamoyl]phenyl]sulfonyl-8-hydroxy-6-methylbicyclo[3.2.1]octane-8-carboxylic acid |
| SMILES | C[C@H]1CC2C[C@@H](S(=O)(=O)c3cc(C(=O)Nc4ccc(F)c(F)c4)ccc3Cl)C[C@H]1[C@@]2(O)C(=O)O |
| InChI | InChI=1S/C23H22ClF2NO6S/c1-11-6-13-8-15(10-16(11)23(13,31)22(29)30)34(32,33)20-7-12(2-4-17(20)24)21(28)27-14-3-5-18(25)19(26)9-14/h2-5,7,9,11,13,15-16,31H,6,8,10H2,1H3,(H,27,28)(H,29,30)/t11-,13?,15+,16+,23+/m0/s1 |
| InChIKey | BALAISXQXNPBLW-OEEIFXLLSA-N |
| XLogP | 3.89 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.95 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |