C27H24ClF3N2O4S — CID 137409791
4-chloro-3-[[(5R,6S,8R)-8-hydroxy-6-methyl-8-pyridin-4-yl-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 137409791) has the molecular formula C27H24ClF3N2O4S and a molecular weight of 565.01 g/mol. Its IUPAC name is 4-chloro-3-[[(5R,6S,8R)-8-hydroxy-6-methyl-8-pyridin-4-yl-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[(5R,6S,8R)-8-hydroxy-6-methyl-8-pyridin-4-yl-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 137409791 |
| Molecular Formula | C27H24ClF3N2O4S |
| Molecular Weight | 565.01 g/mol |
| Exact Mass | 564.11 |
| IUPAC Name | 4-chloro-3-[[(5R,6S,8R)-8-hydroxy-6-methyl-8-pyridin-4-yl-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | C[C@H]1CC2CC(S(=O)(=O)c3cc(C(=O)Nc4cc(F)c(F)c(F)c4)ccc3Cl)C[C@H]1[C@@]2(O)c1ccncc1 |
| InChI | InChI=1S/C27H24ClF3N2O4S/c1-14-8-17-10-19(13-20(14)27(17,35)16-4-6-32-7-5-16)38(36,37)24-9-15(2-3-21(24)28)26(34)33-18-11-22(29)25(31)23(30)12-18/h2-7,9,11-12,14,17,19-20,35H,8,10,13H2,1H3,(H,33,34)/t14-,17?,19?,20+,27+/m0/s1 |
| InChIKey | NDUGXIQATICXTG-AGTCSQJASA-N |
| XLogP | 5.50 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.01 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|