C25H24ClF2NO6S — CID 166736020
4-chloro-N-(3,4-difluorophenyl)-3-[[(6S,8R)-8-hydroxy-6-methyl-8-(2-oxopropanoyl)-3-bicyclo[3.2.1]octanyl]sulfonyl]benzamide (PubChem CID 166736020) has the molecular formula C25H24ClF2NO6S and a molecular weight of 539.98 g/mol. Its IUPAC name is 4-chloro-N-(3,4-difluorophenyl)-3-[[(6S,8R)-8-hydroxy-6-methyl-8-(2-oxopropanoyl)-3-bicyclo[3.2.1]octanyl]sulfonyl]benzamide.
| Compound Name | 4-chloro-N-(3,4-difluorophenyl)-3-[[(6S,8R)-8-hydroxy-6-methyl-8-(2-oxopropanoyl)-3-bicyclo[3.2.1]octanyl]sulfonyl]benzamide |
|---|---|
| PubChem CID | 166736020 |
| Molecular Formula | C25H24ClF2NO6S |
| Molecular Weight | 539.98 g/mol |
| Exact Mass | 539.10 |
| IUPAC Name | 4-chloro-N-(3,4-difluorophenyl)-3-[[(6S,8R)-8-hydroxy-6-methyl-8-(2-oxopropanoyl)-3-bicyclo[3.2.1]octanyl]sulfonyl]benzamide |
| SMILES | CC(=O)C(=O)[C@@]1(O)C2CC(S(=O)(=O)c3cc(C(=O)Nc4ccc(F)c(F)c4)ccc3Cl)CC1[C@@H](C)C2 |
| InChI | InChI=1S/C25H24ClF2NO6S/c1-12-7-15-9-17(11-18(12)25(15,33)23(31)13(2)30)36(34,35)22-8-14(3-5-19(22)26)24(32)29-16-4-6-20(27)21(28)10-16/h3-6,8,10,12,15,17-18,33H,7,9,11H2,1-2H3,(H,29,32)/t12-,15?,17?,18?,25+/m0/s1 |
| InChIKey | SHFXCVIGIRMTPC-DCSXGYSISA-N |
| XLogP | 3.97 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.98 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|