C25H27ClF3N3O5S — CID 130402165
3-[[(3R,6S,8R)-8-[[(2-aminoacetyl)amino]methyl]-8-hydroxy-6-methyl-3-bicyclo[3.2.1]octanyl]sulfonyl]-4-chloro-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130402165) has the molecular formula C25H27ClF3N3O5S and a molecular weight of 574.02 g/mol. Its IUPAC name is 3-[[(3R,6S,8R)-8-[[(2-aminoacetyl)amino]methyl]-8-hydroxy-6-methyl-3-bicyclo[3.2.1]octanyl]sulfonyl]-4-chloro-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 3-[[(3R,6S,8R)-8-[[(2-aminoacetyl)amino]methyl]-8-hydroxy-6-methyl-3-bicyclo[3.2.1]octanyl]sulfonyl]-4-chloro-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130402165 |
| Molecular Formula | C25H27ClF3N3O5S |
| Molecular Weight | 574.02 g/mol |
| Exact Mass | 573.13 |
| IUPAC Name | 3-[[(3R,6S,8R)-8-[[(2-aminoacetyl)amino]methyl]-8-hydroxy-6-methyl-3-bicyclo[3.2.1]octanyl]sulfonyl]-4-chloro-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | C[C@H]1CC2C[C@@H](S(=O)(=O)c3cc(C(=O)Nc4cc(F)c(F)c(F)c4)ccc3Cl)CC1[C@@]2(O)CNC(=O)CN |
| InChI | InChI=1S/C25H27ClF3N3O5S/c1-12-4-14-6-16(9-17(12)25(14,35)11-31-22(33)10-30)38(36,37)21-5-13(2-3-18(21)26)24(34)32-15-7-19(27)23(29)20(28)8-15/h2-3,5,7-8,12,14,16-17,35H,4,6,9-11,30H2,1H3,(H,31,33)(H,32,34)/t12-,14?,16+,17?,25+/m0/s1 |
| InChIKey | NMLVPNONVIFUHC-LWTNDQEKSA-N |
| XLogP | 3.02 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.02 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|