C27H31ClF3NO7S — CID 174096146
4-chloro-3-[[(3R,6S,8R)-8-[[(2S,3S)-2,3-dihydroxybutoxy]methyl]-8-hydroxy-6-methyl-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 174096146) has the molecular formula C27H31ClF3NO7S and a molecular weight of 606.06 g/mol. Its IUPAC name is 4-chloro-3-[[(3R,6S,8R)-8-[[(2S,3S)-2,3-dihydroxybutoxy]methyl]-8-hydroxy-6-methyl-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[(3R,6S,8R)-8-[[(2S,3S)-2,3-dihydroxybutoxy]methyl]-8-hydroxy-6-methyl-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 174096146 |
| Molecular Formula | C27H31ClF3NO7S |
| Molecular Weight | 606.06 g/mol |
| Exact Mass | 605.15 |
| IUPAC Name | 4-chloro-3-[[(3R,6S,8R)-8-[[(2S,3S)-2,3-dihydroxybutoxy]methyl]-8-hydroxy-6-methyl-3-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | C[C@H](O)[C@@H](O)COC[C@@]1(O)C2C[C@@H](S(=O)(=O)c3cc(C(=O)Nc4cc(F)c(F)c(F)c4)ccc3Cl)CC1[C@@H](C)C2 |
| InChI | InChI=1S/C27H31ClF3NO7S/c1-13-5-16-7-18(10-19(13)27(16,36)12-39-11-23(34)14(2)33)40(37,38)24-6-15(3-4-20(24)28)26(35)32-17-8-21(29)25(31)22(30)9-17/h3-4,6,8-9,13-14,16,18-19,23,33-34,36H,5,7,10-12H2,1-2H3,(H,32,35)/t13-,14-,16?,18+,19?,23-,27+/m0/s1 |
| InChIKey | XXOXKOOXCBRYSL-NUYIKNKDSA-N |
| XLogP | 3.71 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.06 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|