C25H23ClF3N3O3S — CID 130402246
4-chloro-3-[[3-(pyrazol-1-ylmethyl)-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130402246) has the molecular formula C25H23ClF3N3O3S and a molecular weight of 537.99 g/mol. Its IUPAC name is 4-chloro-3-[[3-(pyrazol-1-ylmethyl)-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[3-(pyrazol-1-ylmethyl)-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130402246 |
| Molecular Formula | C25H23ClF3N3O3S |
| Molecular Weight | 537.99 g/mol |
| Exact Mass | 537.11 |
| IUPAC Name | 4-chloro-3-[[3-(pyrazol-1-ylmethyl)-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(Cl)c(S(=O)(=O)C2C3CCC2CC(Cn2cccn2)C3)c1 |
| InChI | InChI=1S/C25H23ClF3N3O3S/c26-19-5-4-17(25(33)31-18-11-20(27)23(29)21(28)12-18)10-22(19)36(34,35)24-15-2-3-16(24)9-14(8-15)13-32-7-1-6-30-32/h1,4-7,10-12,14-16,24H,2-3,8-9,13H2,(H,31,33) |
| InChIKey | FHTIKBGHJXEMFH-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.99 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|