C25H26ClF3N2O5S — CID 154959420
[(1S,5S)-8-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-bicyclo[3.2.1]octanyl]methyl N-ethylcarbamate (PubChem CID 154959420) has the molecular formula C25H26ClF3N2O5S and a molecular weight of 559.01 g/mol. Its IUPAC name is [(1S,5S)-8-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-bicyclo[3.2.1]octanyl]methyl N-ethylcarbamate.
| Compound Name | [(1S,5S)-8-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-bicyclo[3.2.1]octanyl]methyl N-ethylcarbamate |
|---|---|
| PubChem CID | 154959420 |
| Molecular Formula | C25H26ClF3N2O5S |
| Molecular Weight | 559.01 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | [(1S,5S)-8-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-bicyclo[3.2.1]octanyl]methyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCC1C[C@@H]2CC[C@@H](C1)C2S(=O)(=O)c1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C25H26ClF3N2O5S/c1-2-30-25(33)36-12-13-7-14-3-4-15(8-13)23(14)37(34,35)21-9-16(5-6-18(21)26)24(32)31-17-10-19(27)22(29)20(28)11-17/h5-6,9-11,13-15,23H,2-4,7-8,12H2,1H3,(H,30,33)(H,31,32)/t13?,14-,15-,23?/m0/s1 |
| InChIKey | ZJWJRTKFISLIGS-LCWHGTPUSA-N |
| XLogP | 5.33 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.01 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|