C23H22ClF3N2O5S — CID 130425306
[(2S,7R)-7-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-2-bicyclo[2.2.1]heptanyl]methyl N-methylcarbamate (PubChem CID 130425306) has the molecular formula C23H22ClF3N2O5S and a molecular weight of 530.95 g/mol. Its IUPAC name is [(2S,7R)-7-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-2-bicyclo[2.2.1]heptanyl]methyl N-methylcarbamate.
| Compound Name | [(2S,7R)-7-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-2-bicyclo[2.2.1]heptanyl]methyl N-methylcarbamate |
|---|---|
| PubChem CID | 130425306 |
| Molecular Formula | C23H22ClF3N2O5S |
| Molecular Weight | 530.95 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | [(2S,7R)-7-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-2-bicyclo[2.2.1]heptanyl]methyl N-methylcarbamate |
| SMILES | CNC(=O)OC[C@H]1CC2CCC1[C@@H]2S(=O)(=O)c1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C23H22ClF3N2O5S/c1-28-23(31)34-10-13-6-11-2-4-15(13)21(11)35(32,33)19-7-12(3-5-16(19)24)22(30)29-14-8-17(25)20(27)18(26)9-14/h3,5,7-9,11,13,15,21H,2,4,6,10H2,1H3,(H,28,31)(H,29,30)/t11?,13-,15?,21-/m1/s1 |
| InChIKey | JZCXPCQMUOCPNV-MGKKDLKOSA-N |
| XLogP | 4.55 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.95 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|