C23H19ClF3N3O3S — CID 130425397
4-chloro-3-[[(2R,7R)-2-(1H-imidazol-2-yl)-7-bicyclo[2.2.1]heptanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130425397) has the molecular formula C23H19ClF3N3O3S and a molecular weight of 509.94 g/mol. Its IUPAC name is 4-chloro-3-[[(2R,7R)-2-(1H-imidazol-2-yl)-7-bicyclo[2.2.1]heptanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[(2R,7R)-2-(1H-imidazol-2-yl)-7-bicyclo[2.2.1]heptanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130425397 |
| Molecular Formula | C23H19ClF3N3O3S |
| Molecular Weight | 509.94 g/mol |
| Exact Mass | 509.08 |
| IUPAC Name | 4-chloro-3-[[(2R,7R)-2-(1H-imidazol-2-yl)-7-bicyclo[2.2.1]heptanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(Cl)c(S(=O)(=O)[C@@H]2C3CCC2[C@H](c2ncc[nH]2)C3)c1 |
| InChI | InChI=1S/C23H19ClF3N3O3S/c24-16-4-2-12(23(31)30-13-9-17(25)20(27)18(26)10-13)8-19(16)34(32,33)21-11-1-3-14(21)15(7-11)22-28-5-6-29-22/h2,4-6,8-11,14-15,21H,1,3,7H2,(H,28,29)(H,30,31)/t11?,14?,15-,21-/m1/s1 |
| InChIKey | WDXMUOYGFFHOGL-SEANCYALSA-N |
| XLogP | 5.09 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.94 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|