C19H17ClF3NO4S — CID 130425110
4-chloro-3-(3-hydroxycyclohexyl)sulfonyl-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130425110) has the molecular formula C19H17ClF3NO4S and a molecular weight of 447.86 g/mol. Its IUPAC name is 4-chloro-3-(3-hydroxycyclohexyl)sulfonyl-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-(3-hydroxycyclohexyl)sulfonyl-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130425110 |
| Molecular Formula | C19H17ClF3NO4S |
| Molecular Weight | 447.86 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | 4-chloro-3-(3-hydroxycyclohexyl)sulfonyl-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(Cl)c(S(=O)(=O)C2CCCC(O)C2)c1 |
| InChI | InChI=1S/C19H17ClF3NO4S/c20-14-5-4-10(19(26)24-11-7-15(21)18(23)16(22)8-11)6-17(14)29(27,28)13-3-1-2-12(25)9-13/h4-8,12-13,25H,1-3,9H2,(H,24,26) |
| InChIKey | VVZKHRHBVPDLMV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.86 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|