C19H18ClF3N2O3S — CID 130397526
4-chloro-3-(1-methylpiperidin-4-yl)sulfonyl-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130397526) has the molecular formula C19H18ClF3N2O3S and a molecular weight of 446.88 g/mol. Its IUPAC name is 4-chloro-3-(1-methylpiperidin-4-yl)sulfonyl-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-(1-methylpiperidin-4-yl)sulfonyl-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130397526 |
| Molecular Formula | C19H18ClF3N2O3S |
| Molecular Weight | 446.88 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 4-chloro-3-(1-methylpiperidin-4-yl)sulfonyl-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | CN1CCC(S(=O)(=O)c2cc(C(=O)Nc3cc(F)c(F)c(F)c3)ccc2Cl)CC1 |
| InChI | InChI=1S/C19H18ClF3N2O3S/c1-25-6-4-13(5-7-25)29(27,28)17-8-11(2-3-14(17)20)19(26)24-12-9-15(21)18(23)16(22)10-12/h2-3,8-10,13H,4-7H2,1H3,(H,24,26) |
| InChIKey | HBMMBOHXOOHDQJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.88 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|